C13H14FN3O6 — CID 123963877
(2,5-dihydroxypyrrol-1-yl) 5-(5-fluoro-2,4-dioxopyrimidin-1-yl)pentanoate (PubChem CID 123963877) has the molecular formula C13H14FN3O6 and a molecular weight of 327.27 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 5-(5-fluoro-2,4-dioxopyrimidin-1-yl)pentanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 5-(5-fluoro-2,4-dioxopyrimidin-1-yl)pentanoate |
|---|---|
| PubChem CID | 123963877 |
| Molecular Formula | C13H14FN3O6 |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 5-(5-fluoro-2,4-dioxopyrimidin-1-yl)pentanoate |
| SMILES | O=C(CCCCn1cc(F)c(=O)[nH]c1=O)On1c(O)ccc1O |
| InChI | InChI=1S/C13H14FN3O6/c14-8-7-16(13(22)15-12(8)21)6-2-1-3-11(20)23-17-9(18)4-5-10(17)19/h4-5,7,18-19H,1-3,6H2,(H,15,21,22) |
| InChIKey | YPWJSNPPCGBYAS-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 126.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|