C12H18N2O5 — CID 123659598
(2,5-dihydroxypyrrol-1-yl) 5-oxo-5-(propylamino)pentanoate (PubChem CID 123659598) has the molecular formula C12H18N2O5 and a molecular weight of 270.28 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 5-oxo-5-(propylamino)pentanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 5-oxo-5-(propylamino)pentanoate |
|---|---|
| PubChem CID | 123659598 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 5-oxo-5-(propylamino)pentanoate |
| SMILES | CCCNC(=O)CCCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C12H18N2O5/c1-2-8-13-9(15)4-3-5-12(18)19-14-10(16)6-7-11(14)17/h6-7,16-17H,2-5,8H2,1H3,(H,13,15) |
| InChIKey | HNJVAMUXWBTPPK-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |