C30H26O4S2 — CID 123969461
S-[2-[4-[4-[4-[2-(2-methylprop-2-enoylsulfanyl)ethenoxy]phenyl]phenyl]phenoxy]ethenyl] 2-methylprop-2-enethioate (PubChem CID 123969461) has the molecular formula C30H26O4S2 and a molecular weight of 514.67 g/mol. Its IUPAC name is S-[2-[4-[4-[4-[2-(2-methylprop-2-enoylsulfanyl)ethenoxy]phenyl]phenyl]phenoxy]ethenyl] 2-methylprop-2-enethioate.
| Compound Name | S-[2-[4-[4-[4-[2-(2-methylprop-2-enoylsulfanyl)ethenoxy]phenyl]phenyl]phenoxy]ethenyl] 2-methylprop-2-enethioate |
|---|---|
| PubChem CID | 123969461 |
| Molecular Formula | C30H26O4S2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | S-[2-[4-[4-[4-[2-(2-methylprop-2-enoylsulfanyl)ethenoxy]phenyl]phenyl]phenoxy]ethenyl] 2-methylprop-2-enethioate |
| SMILES | C=C(C)C(=O)SC=COc1ccc(-c2ccc(-c3ccc(OC=CSC(=O)C(=C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H26O4S2/c1-21(2)29(31)35-19-17-33-27-13-9-25(10-14-27)23-5-7-24(8-6-23)26-11-15-28(16-12-26)34-18-20-36-30(32)22(3)4/h5-20H,1,3H2,2,4H3 |
| InChIKey | PPQMPXONTJRMEV-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|