C28H41N8O3+ — CID 123975310
2-[4-[[6-(cyclohexylamino)-7H-purin-9-ium-2-yl]amino]-3-methoxyphenyl]-1-[(3R)-3-hydroxypiperidin-4-yl]piperidin-3-ol (PubChem CID 123975310) has the molecular formula C28H41N8O3+ and a molecular weight of 537.69 g/mol. Its IUPAC name is 2-[4-[[6-(cyclohexylamino)-7H-purin-9-ium-2-yl]amino]-3-methoxyphenyl]-1-[(3R)-3-hydroxypiperidin-4-yl]piperidin-3-ol.
| Compound Name | 2-[4-[[6-(cyclohexylamino)-7H-purin-9-ium-2-yl]amino]-3-methoxyphenyl]-1-[(3R)-3-hydroxypiperidin-4-yl]piperidin-3-ol |
|---|---|
| PubChem CID | 123975310 |
| Molecular Formula | C28H41N8O3+ |
| Molecular Weight | 537.69 g/mol |
| Exact Mass | 537.33 |
| IUPAC Name | 2-[4-[[6-(cyclohexylamino)-7H-purin-9-ium-2-yl]amino]-3-methoxyphenyl]-1-[(3R)-3-hydroxypiperidin-4-yl]piperidin-3-ol |
| SMILES | COc1cc(C2C(O)CCCN2C2CCNC[C@H]2O)ccc1Nc1nc(NC2CCCCC2)c2[nH]c[nH+]c2n1 |
| InChI | InChI=1S/C28H40N8O3/c1-39-23-14-17(25-21(37)8-5-13-36(25)20-11-12-29-15-22(20)38)9-10-19(23)33-28-34-26-24(30-16-31-26)27(35-28)32-18-6-3-2-4-7-18/h9-10,14,16,18,20-22,25,29,37-38H,2-8,11-13,15H2,1H3,(H3,30,31,32,33,34,35)/p+1/t20?,21?,22-,25?/m1/s1 |
| InChIKey | KWWILEDGLXFGSZ-MKNDZYQNSA-O |
| XLogP | 2.49 |
| TPSA | 144.73 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.69 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |