C17H22N7O2S+ — CID 123779762
N-[4-[[6-(cyclopentylamino)-7H-purin-9-ium-2-yl]amino]phenyl]methanesulfonamide (PubChem CID 123779762) has the molecular formula C17H22N7O2S+ and a molecular weight of 388.48 g/mol. Its IUPAC name is N-[4-[[6-(cyclopentylamino)-7H-purin-9-ium-2-yl]amino]phenyl]methanesulfonamide.
| Compound Name | N-[4-[[6-(cyclopentylamino)-7H-purin-9-ium-2-yl]amino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 123779762 |
| Molecular Formula | C17H22N7O2S+ |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-[4-[[6-(cyclopentylamino)-7H-purin-9-ium-2-yl]amino]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(Nc2nc(NC3CCCC3)c3[nH]c[nH+]c3n2)cc1 |
| InChI | InChI=1S/C17H21N7O2S/c1-27(25,26)24-13-8-6-12(7-9-13)21-17-22-15-14(18-10-19-15)16(23-17)20-11-4-2-3-5-11/h6-11,24H,2-5H2,1H3,(H3,18,19,20,21,22,23)/p+1 |
| InChIKey | QLCKXQBMKBQMQF-UHFFFAOYSA-O |
| XLogP | 2.24 |
| TPSA | 125.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |