About (3-ethyl-2,6-difluorocyclohexa-2,4-dien-1-yl)methanol
(3-ethyl-2,6-difluorocyclohexa-2,4-dien-1-yl)methanol (PubChem CID 123977269) has the molecular formula C9H12F2O
and a molecular weight of 174.19 g/mol. Its IUPAC name is (3-ethyl-2,6-difluorocyclohexa-2,4-dien-1-yl)methanol.
Analyze (3-ethyl-2,6-difluorocyclohexa-2,4-dien-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethyl-2,6-difluorocyclohexa-2,4-dien-1-yl)methanol?
The IUPAC name of (3-ethyl-2,6-difluorocyclohexa-2,4-dien-1-yl)methanol (CID 123977269) is (3-ethyl-2,6-difluorocyclohexa-2,4-dien-1-yl)methanol.
What is the SMILES notation for (3-ethyl-2,6-difluorocyclohexa-2,4-dien-1-yl)methanol?
The canonical SMILES for (3-ethyl-2,6-difluorocyclohexa-2,4-dien-1-yl)methanol is CCC1=C(F)C(CO)C(F)C=C1.
What is the InChIKey of (3-ethyl-2,6-difluorocyclohexa-2,4-dien-1-yl)methanol?
The InChIKey is HFTUKIAPKPIBLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12F2O/c1-2-6-3-4-8(10)7(5-12)9(6)11/h3-4,7-8,12H,2,5H2,1H3.
What are the key properties of (3-ethyl-2,6-difluorocyclohexa-2,4-dien-1-yl)methanol?
(3-ethyl-2,6-difluorocyclohexa-2,4-dien-1-yl)methanol has a molecular weight of 174.19 g/mol, XLogP of 2.14, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethyl-2,6-difluorocyclohexa-2,4-dien-1-yl)methanol is sourced from PubChem (CID 123977269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).