C12H16O — CID 123977964
2-prop-1-enyl-10-oxatricyclo[5.2.1.02,6]dec-8-ene (PubChem CID 123977964) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-prop-1-enyl-10-oxatricyclo[5.2.1.02,6]dec-8-ene.
| Compound Name | 2-prop-1-enyl-10-oxatricyclo[5.2.1.02,6]dec-8-ene |
|---|---|
| PubChem CID | 123977964 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 2-prop-1-enyl-10-oxatricyclo[5.2.1.02,6]dec-8-ene |
| SMILES | CC=CC12CCCC1C1C=CC2O1 |
| InChI | InChI=1S/C12H16O/c1-2-7-12-8-3-4-9(12)10-5-6-11(12)13-10/h2,5-7,9-11H,3-4,8H2,1H3 |
| InChIKey | AGKGUYKIVHGUHW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|