C35H45N3O2S — CID 123985156
4-[4-(2-methyl-N-propylanilino)but-1-en-2-yl]-N-[3-(3-oxocyclohexyl)propyl]-3-(thiophen-3-ylmethylamino)benzamide (PubChem CID 123985156) has the molecular formula C35H45N3O2S and a molecular weight of 571.83 g/mol. Its IUPAC name is 4-[4-(2-methyl-N-propylanilino)but-1-en-2-yl]-N-[3-(3-oxocyclohexyl)propyl]-3-(thiophen-3-ylmethylamino)benzamide.
| Compound Name | 4-[4-(2-methyl-N-propylanilino)but-1-en-2-yl]-N-[3-(3-oxocyclohexyl)propyl]-3-(thiophen-3-ylmethylamino)benzamide |
|---|---|
| PubChem CID | 123985156 |
| Molecular Formula | C35H45N3O2S |
| Molecular Weight | 571.83 g/mol |
| Exact Mass | 571.32 |
| IUPAC Name | 4-[4-(2-methyl-N-propylanilino)but-1-en-2-yl]-N-[3-(3-oxocyclohexyl)propyl]-3-(thiophen-3-ylmethylamino)benzamide |
| SMILES | C=C(CCN(CCC)c1ccccc1C)c1ccc(C(=O)NCCCC2CCCC(=O)C2)cc1NCc1ccsc1 |
| InChI | InChI=1S/C35H45N3O2S/c1-4-19-38(34-13-6-5-9-27(34)3)20-16-26(2)32-15-14-30(23-33(32)37-24-29-17-21-41-25-29)35(40)36-18-8-11-28-10-7-12-31(39)22-28/h5-6,9,13-15,17,21,23,25,28,37H,2,4,7-8,10-12,16,18-20,22,24H2,1,3H3,(H,36,40) |
| InChIKey | WXFJUKTUUMBNSX-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.83 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|