C16H22S — CID 123985171
2-hexa-2,4-dien-3-yl-6-pent-2-en-3-yl-4H-thiopyran (PubChem CID 123985171) has the molecular formula C16H22S and a molecular weight of 246.42 g/mol. Its IUPAC name is 2-hexa-2,4-dien-3-yl-6-pent-2-en-3-yl-4H-thiopyran.
| Compound Name | 2-hexa-2,4-dien-3-yl-6-pent-2-en-3-yl-4H-thiopyran |
|---|---|
| PubChem CID | 123985171 |
| Molecular Formula | C16H22S |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 2-hexa-2,4-dien-3-yl-6-pent-2-en-3-yl-4H-thiopyran |
| SMILES | CC=CC(=CC)C1=CCC=C(C(=CC)CC)S1 |
| InChI | InChI=1S/C16H22S/c1-5-10-14(8-4)16-12-9-11-15(17-16)13(6-2)7-3/h5-6,8,10-12H,7,9H2,1-4H3 |
| InChIKey | LUBUCUZJLZVOIX-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|