C8H14FN — CID 123986678
5-fluoro-N,N-dimethylhexa-2,4-dien-2-amine (PubChem CID 123986678) has the molecular formula C8H14FN and a molecular weight of 143.20 g/mol. Its IUPAC name is 5-fluoro-N,N-dimethylhexa-2,4-dien-2-amine.
| Compound Name | 5-fluoro-N,N-dimethylhexa-2,4-dien-2-amine |
|---|---|
| PubChem CID | 123986678 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | 5-fluoro-N,N-dimethylhexa-2,4-dien-2-amine |
| SMILES | CC(F)=CC=C(C)N(C)C |
| InChI | InChI=1S/C8H14FN/c1-7(9)5-6-8(2)10(3)4/h5-6H,1-4H3 |
| InChIKey | JEOLGAQUDMMUCA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|