C34H43F5 — CID 123987022
2-fluoro-4-(4-pentylphenyl)-1-[2-[4-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]cyclohexyl]ethyl]benzene (PubChem CID 123987022) has the molecular formula C34H43F5 and a molecular weight of 546.71 g/mol. Its IUPAC name is 2-fluoro-4-(4-pentylphenyl)-1-[2-[4-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]cyclohexyl]ethyl]benzene.
| Compound Name | 2-fluoro-4-(4-pentylphenyl)-1-[2-[4-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]cyclohexyl]ethyl]benzene |
|---|---|
| PubChem CID | 123987022 |
| Molecular Formula | C34H43F5 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | 2-fluoro-4-(4-pentylphenyl)-1-[2-[4-[4-(1,3,3,3-tetrafluoroprop-1-enyl)cyclohexyl]cyclohexyl]ethyl]benzene |
| SMILES | CCCCCc1ccc(-c2ccc(CCC3CCC(C4CCC(C(F)=CC(F)(F)F)CC4)CC3)c(F)c2)cc1 |
| InChI | InChI=1S/C34H43F5/c1-2-3-4-5-24-6-13-28(14-7-24)31-21-20-29(32(35)22-31)15-10-25-8-11-26(12-9-25)27-16-18-30(19-17-27)33(36)23-34(37,38)39/h6-7,13-14,20-23,25-27,30H,2-5,8-12,15-19H2,1H3 |
| InChIKey | GSRNWAMYWWJHTJ-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|