C15H18FN3O — CID 123987575
1-[4-(4,6-dimethylpyrimidin-5-yl)-2-fluorophenoxy]-N,N-dimethylmethanamine (PubChem CID 123987575) has the molecular formula C15H18FN3O and a molecular weight of 275.33 g/mol. Its IUPAC name is 1-[4-(4,6-dimethylpyrimidin-5-yl)-2-fluorophenoxy]-N,N-dimethylmethanamine.
| Compound Name | 1-[4-(4,6-dimethylpyrimidin-5-yl)-2-fluorophenoxy]-N,N-dimethylmethanamine |
|---|---|
| PubChem CID | 123987575 |
| Molecular Formula | C15H18FN3O |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 1-[4-(4,6-dimethylpyrimidin-5-yl)-2-fluorophenoxy]-N,N-dimethylmethanamine |
| SMILES | Cc1ncnc(C)c1-c1ccc(OCN(C)C)c(F)c1 |
| InChI | InChI=1S/C15H18FN3O/c1-10-15(11(2)18-8-17-10)12-5-6-14(13(16)7-12)20-9-19(3)4/h5-8H,9H2,1-4H3 |
| InChIKey | UJISLMJHIQEVKV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|