C20H24O2Si — CID 123990238
4-(4-tert-butylphenyl)-6-(4-methylphenyl)-3-oxa-1-oxonia-2-silanidacyclohex-4-ene (PubChem CID 123990238) has the molecular formula C20H24O2Si and a molecular weight of 324.50 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-6-(4-methylphenyl)-3-oxa-1-oxonia-2-silanidacyclohex-4-ene.
| Compound Name | 4-(4-tert-butylphenyl)-6-(4-methylphenyl)-3-oxa-1-oxonia-2-silanidacyclohex-4-ene |
|---|---|
| PubChem CID | 123990238 |
| Molecular Formula | C20H24O2Si |
| Molecular Weight | 324.50 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 4-(4-tert-butylphenyl)-6-(4-methylphenyl)-3-oxa-1-oxonia-2-silanidacyclohex-4-ene |
| SMILES | Cc1ccc(C2C=C(c3ccc(C(C)(C)C)cc3)O[SiH-][OH+]2)cc1 |
| InChI | InChI=1S/C20H24O2Si/c1-14-5-7-15(8-6-14)18-13-19(22-23-21-18)16-9-11-17(12-10-16)20(2,3)4/h5-13,18,21,23H,1-4H3 |
| InChIKey | YXXZGWDDCBYXLW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 22.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.50 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|