C8H12N2 — CID 123991309
2,3-di(ethylidene)-1,4-dihydropyrazine (PubChem CID 123991309) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 2,3-di(ethylidene)-1,4-dihydropyrazine.
| Compound Name | 2,3-di(ethylidene)-1,4-dihydropyrazine |
|---|---|
| PubChem CID | 123991309 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 2,3-di(ethylidene)-1,4-dihydropyrazine |
| SMILES | CC=C1NC=CNC1=CC |
| InChI | InChI=1S/C8H12N2/c1-3-7-8(4-2)10-6-5-9-7/h3-6,9-10H,1-2H3 |
| InChIKey | HPWSFXABAFKLDQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |