C7H11FN2 — CID 173102336
2-fluoro-N,N-dimethyl-1,2-dihydropyridin-3-amine (PubChem CID 173102336) has the molecular formula C7H11FN2 and a molecular weight of 142.18 g/mol. Its IUPAC name is 2-fluoro-N,N-dimethyl-1,2-dihydropyridin-3-amine.
| Compound Name | 2-fluoro-N,N-dimethyl-1,2-dihydropyridin-3-amine |
|---|---|
| PubChem CID | 173102336 |
| Molecular Formula | C7H11FN2 |
| Molecular Weight | 142.18 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | 2-fluoro-N,N-dimethyl-1,2-dihydropyridin-3-amine |
| SMILES | CN(C)C1=CC=CNC1F |
| InChI | InChI=1S/C7H11FN2/c1-10(2)6-4-3-5-9-7(6)8/h3-5,7,9H,1-2H3 |
| InChIKey | WJWOJCCKBCXOPT-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.18 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|