C16H16N2O3S — CID 1240508
(4R)-7,7-dimethyl-4-thiophen-2-yl-2,4,6,8-tetrahydro-1H-chromeno[2,3-c]pyrazole-3,5-dione (PubChem CID 1240508) has the molecular formula C16H16N2O3S and a molecular weight of 316.38 g/mol. Its IUPAC name is (4R)-7,7-dimethyl-4-thiophen-2-yl-2,4,6,8-tetrahydro-1H-chromeno[2,3-c]pyrazole-3,5-dione.
| Compound Name | (4R)-7,7-dimethyl-4-thiophen-2-yl-2,4,6,8-tetrahydro-1H-chromeno[2,3-c]pyrazole-3,5-dione |
|---|---|
| PubChem CID | 1240508 |
| Molecular Formula | C16H16N2O3S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | (4R)-7,7-dimethyl-4-thiophen-2-yl-2,4,6,8-tetrahydro-1H-chromeno[2,3-c]pyrazole-3,5-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)Oc1[nH][nH]c(=O)c1[C@@H]2c1cccs1 |
| InChI | InChI=1S/C16H16N2O3S/c1-16(2)6-8(19)11-9(7-16)21-15-13(14(20)17-18-15)12(11)10-4-3-5-22-10/h3-5,12H,6-7H2,1-2H3,(H2,17,18,20)/t12-/m1/s1 |
| InChIKey | QPYDQSQGXDABNV-GFCCVEGCSA-N |
| XLogP | 2.93 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |