About (2R)-N-(5-tert-butyl-1,3-oxazol-2-yl)-2-chloropentanamide
(2R)-N-(5-tert-butyl-1,3-oxazol-2-yl)-2-chloropentanamide (PubChem CID 124500401) has the molecular formula C12H19ClN2O2
and a molecular weight of 258.75 g/mol. Its IUPAC name is (2R)-N-(5-tert-butyl-1,3-oxazol-2-yl)-2-chloropentanamide.
Molecular Properties
| Compound Name | (2R)-N-(5-tert-butyl-1,3-oxazol-2-yl)-2-chloropentanamide |
| PubChem CID | 124500401 |
| Molecular Formula | C12H19ClN2O2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (2R)-N-(5-tert-butyl-1,3-oxazol-2-yl)-2-chloropentanamide |
| SMILES | CCC[C@@H](Cl)C(=O)Nc1ncc(C(C)(C)C)o1 |
| InChI | InChI=1S/C12H19ClN2O2/c1-5-6-8(13)10(16)15-11-14-7-9(17-11)12(2,3)4/h7-8H,5-6H2,1-4H3,(H,14,15,16)/t8-/m1/s1 |
| InChIKey | DTMHJPVIJSHAPV-MRVPVSSYSA-N |
| XLogP | 3.32 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2R)-N-(5-tert-butyl-1,3-oxazol-2-yl)-2-chloropentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-(5-tert-butyl-1,3-oxazol-2-yl)-2-chloropentanamide?
The IUPAC name of (2R)-N-(5-tert-butyl-1,3-oxazol-2-yl)-2-chloropentanamide (CID 124500401) is (2R)-N-(5-tert-butyl-1,3-oxazol-2-yl)-2-chloropentanamide.
What is the SMILES notation for (2R)-N-(5-tert-butyl-1,3-oxazol-2-yl)-2-chloropentanamide?
The canonical SMILES for (2R)-N-(5-tert-butyl-1,3-oxazol-2-yl)-2-chloropentanamide is CCC[C@@H](Cl)C(=O)Nc1ncc(C(C)(C)C)o1.
What is the InChIKey of (2R)-N-(5-tert-butyl-1,3-oxazol-2-yl)-2-chloropentanamide?
The InChIKey is DTMHJPVIJSHAPV-MRVPVSSYSA-N. The full InChI is InChI=1S/C12H19ClN2O2/c1-5-6-8(13)10(16)15-11-14-7-9(17-11)12(2,3)4/h7-8H,5-6H2,1-4H3,(H,14,15,16)/t8-/m1/s1.
What are the key properties of (2R)-N-(5-tert-butyl-1,3-oxazol-2-yl)-2-chloropentanamide?
(2R)-N-(5-tert-butyl-1,3-oxazol-2-yl)-2-chloropentanamide has a molecular weight of 258.75 g/mol, XLogP of 3.32, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-(5-tert-butyl-1,3-oxazol-2-yl)-2-chloropentanamide is sourced from PubChem (CID 124500401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).