C12H19ClN2O2 — CID 124500401
(2R)-N-(5-tert-butyl-1,3-oxazol-2-yl)-2-chloropentanamide (PubChem CID 124500401) has the molecular formula C12H19ClN2O2 and a molecular weight of 258.75 g/mol. Its IUPAC name is (2R)-N-(5-tert-butyl-1,3-oxazol-2-yl)-2-chloropentanamide.
| Compound Name | (2R)-N-(5-tert-butyl-1,3-oxazol-2-yl)-2-chloropentanamide |
|---|---|
| PubChem CID | 124500401 |
| Molecular Formula | C12H19ClN2O2 |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (2R)-N-(5-tert-butyl-1,3-oxazol-2-yl)-2-chloropentanamide |
| SMILES | CCC[C@@H](Cl)C(=O)Nc1ncc(C(C)(C)C)o1 |
| InChI | InChI=1S/C12H19ClN2O2/c1-5-6-8(13)10(16)15-11-14-7-9(17-11)12(2,3)4/h7-8H,5-6H2,1-4H3,(H,14,15,16)/t8-/m1/s1 |
| InChIKey | DTMHJPVIJSHAPV-MRVPVSSYSA-N |
| XLogP | 3.32 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|