C7H12N2 — CID 124517902
N,N-dimethyl-1-(3H-pyrrol-2-yl)methanamine (PubChem CID 124517902) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is N,N-dimethyl-1-(3H-pyrrol-2-yl)methanamine.
| Compound Name | N,N-dimethyl-1-(3H-pyrrol-2-yl)methanamine |
|---|---|
| PubChem CID | 124517902 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | N,N-dimethyl-1-(3H-pyrrol-2-yl)methanamine |
| SMILES | CN(C)CC1=NC=CC1 |
| InChI | InChI=1S/C7H12N2/c1-9(2)6-7-4-3-5-8-7/h3,5H,4,6H2,1-2H3 |
| InChIKey | BXTCAKJKASNIPB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |