C20H19N3O2 — CID 124525421
(1S,10R,11S,17S)-14,17-dimethyl-12,14,16-triazahexacyclo[8.7.2.211,17.01,10.02,7.012,16]henicosa-2,4,6,18,20-pentaene-13,15-dione (PubChem CID 124525421) has the molecular formula C20H19N3O2 and a molecular weight of 333.39 g/mol. Its IUPAC name is (1S,10R,11S,17S)-14,17-dimethyl-12,14,16-triazahexacyclo[8.7.2.211,17.01,10.02,7.012,16]henicosa-2,4,6,18,20-pentaene-13,15-dione.
| Compound Name | (1S,10R,11S,17S)-14,17-dimethyl-12,14,16-triazahexacyclo[8.7.2.211,17.01,10.02,7.012,16]henicosa-2,4,6,18,20-pentaene-13,15-dione |
|---|---|
| PubChem CID | 124525421 |
| Molecular Formula | C20H19N3O2 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | (1S,10R,11S,17S)-14,17-dimethyl-12,14,16-triazahexacyclo[8.7.2.211,17.01,10.02,7.012,16]henicosa-2,4,6,18,20-pentaene-13,15-dione |
| SMILES | Cn1c(=O)n2n(c1=O)[C@@]1(C)C=C[C@H]2[C@]23C=C[C@]21c1ccccc1CC3 |
| InChI | InChI=1S/C20H19N3O2/c1-18-9-8-15(22-16(24)21(2)17(25)23(18)22)19-10-7-13-5-3-4-6-14(13)20(18,19)12-11-19/h3-6,8-9,11-12,15H,7,10H2,1-2H3/t15-,18-,19-,20+/m0/s1 |
| InChIKey | UHZSZOQQHVASQC-MVJPYGJCSA-N |
| XLogP | 1.63 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|