C14H12F6 — CID 124525533
(1S,3S,6S,8S)-4,5-bis(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene (PubChem CID 124525533) has the molecular formula C14H12F6 and a molecular weight of 294.24 g/mol. Its IUPAC name is (1S,3S,6S,8S)-4,5-bis(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene.
| Compound Name | (1S,3S,6S,8S)-4,5-bis(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene |
|---|---|
| PubChem CID | 124525533 |
| Molecular Formula | C14H12F6 |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | (1S,3S,6S,8S)-4,5-bis(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4-diene |
| SMILES | FC(F)(F)C1=C(C(F)(F)F)[C@H]2C[C@H]1C1=C2[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C14H12F6/c15-13(16,17)11-7-4-8(12(11)14(18,19)20)10-6-2-1-5(3-6)9(7)10/h5-8H,1-4H2/t5-,6-,7-,8-/m0/s1 |
| InChIKey | UDUVUUDAMMECBW-XAMCCFCMSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|