C12H6F6 — CID 23233732
1,8,9,10,11,11-hexafluorotetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4,9-triene (PubChem CID 23233732) has the molecular formula C12H6F6 and a molecular weight of 264.17 g/mol. Its IUPAC name is 1,8,9,10,11,11-hexafluorotetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4,9-triene.
| Compound Name | 1,8,9,10,11,11-hexafluorotetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4,9-triene |
|---|---|
| PubChem CID | 23233732 |
| Molecular Formula | C12H6F6 |
| Molecular Weight | 264.17 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 1,8,9,10,11,11-hexafluorotetracyclo[6.2.1.13,6.02,7]dodeca-2(7),4,9-triene |
| SMILES | FC1=C(F)C2(F)C3=C(C4C=CC3C4)C1(F)C2(F)F |
| InChI | InChI=1S/C12H6F6/c13-8-9(14)11(16)7-5-2-1-4(3-5)6(7)10(8,15)12(11,17)18/h1-2,4-5H,3H2 |
| InChIKey | KUIOMUAIGKUTAP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.17 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|