C22H13Cl2IN2O3 — CID 124544627
2,4-dichloro-N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-iodophenyl)benzamide (PubChem CID 124544627) has the molecular formula C22H13Cl2IN2O3 and a molecular weight of 551.17 g/mol. Its IUPAC name is 2,4-dichloro-N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-iodophenyl)benzamide.
| Compound Name | 2,4-dichloro-N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-iodophenyl)benzamide |
|---|---|
| PubChem CID | 124544627 |
| Molecular Formula | C22H13Cl2IN2O3 |
| Molecular Weight | 551.17 g/mol |
| Exact Mass | 549.93 |
| IUPAC Name | 2,4-dichloro-N-[(1,3-dioxoisoindol-2-yl)methyl]-N-(2-iodophenyl)benzamide |
| SMILES | O=C1c2ccccc2C(=O)N1CN(C(=O)c1ccc(Cl)cc1Cl)c1ccccc1I |
| InChI | InChI=1S/C22H13Cl2IN2O3/c23-13-9-10-16(17(24)11-13)22(30)26(19-8-4-3-7-18(19)25)12-27-20(28)14-5-1-2-6-15(14)21(27)29/h1-11H,12H2 |
| InChIKey | UXCHLHKKQVQWOV-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.17 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|