C17H22N4O3S — CID 124575218
[(3S)-3-(methylamino)piperidin-1-yl]-[1-(2-methylsulfonylphenyl)pyrazol-4-yl]methanone (PubChem CID 124575218) has the molecular formula C17H22N4O3S and a molecular weight of 362.46 g/mol. Its IUPAC name is [(3S)-3-(methylamino)piperidin-1-yl]-[1-(2-methylsulfonylphenyl)pyrazol-4-yl]methanone.
| Compound Name | [(3S)-3-(methylamino)piperidin-1-yl]-[1-(2-methylsulfonylphenyl)pyrazol-4-yl]methanone |
|---|---|
| PubChem CID | 124575218 |
| Molecular Formula | C17H22N4O3S |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | [(3S)-3-(methylamino)piperidin-1-yl]-[1-(2-methylsulfonylphenyl)pyrazol-4-yl]methanone |
| SMILES | CN[C@H]1CCCN(C(=O)c2cnn(-c3ccccc3S(C)(=O)=O)c2)C1 |
| InChI | InChI=1S/C17H22N4O3S/c1-18-14-6-5-9-20(12-14)17(22)13-10-19-21(11-13)15-7-3-4-8-16(15)25(2,23)24/h3-4,7-8,10-11,14,18H,5-6,9,12H2,1-2H3/t14-/m0/s1 |
| InChIKey | WUPGUMYVFKXHPH-AWEZNQCLSA-N |
| XLogP | 1.10 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |