C14H19N5O2S — CID 124620967
2-[(1R)-1-(1-cyclohexyltetrazol-5-yl)ethyl]sulfonylpyridine (PubChem CID 124620967) has the molecular formula C14H19N5O2S and a molecular weight of 321.41 g/mol. Its IUPAC name is 2-[(1R)-1-(1-cyclohexyltetrazol-5-yl)ethyl]sulfonylpyridine.
| Compound Name | 2-[(1R)-1-(1-cyclohexyltetrazol-5-yl)ethyl]sulfonylpyridine |
|---|---|
| PubChem CID | 124620967 |
| Molecular Formula | C14H19N5O2S |
| Molecular Weight | 321.41 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 2-[(1R)-1-(1-cyclohexyltetrazol-5-yl)ethyl]sulfonylpyridine |
| SMILES | C[C@H](c1nnnn1C1CCCCC1)S(=O)(=O)c1ccccn1 |
| InChI | InChI=1S/C14H19N5O2S/c1-11(22(20,21)13-9-5-6-10-15-13)14-16-17-18-19(14)12-7-3-2-4-8-12/h5-6,9-12H,2-4,7-8H2,1H3/t11-/m1/s1 |
| InChIKey | MGWOENSIPNQBSJ-LLVKDONJSA-N |
| XLogP | 2.11 |
| TPSA | 90.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |