C13H17N5O2S — CID 134093945
N-(1-cyclohexyltetrazol-5-yl)benzenesulfonamide (PubChem CID 134093945) has the molecular formula C13H17N5O2S and a molecular weight of 307.38 g/mol. Its IUPAC name is N-(1-cyclohexyltetrazol-5-yl)benzenesulfonamide.
| Compound Name | N-(1-cyclohexyltetrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 134093945 |
| Molecular Formula | C13H17N5O2S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | N-(1-cyclohexyltetrazol-5-yl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1nnnn1C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C13H17N5O2S/c19-21(20,12-9-5-2-6-10-12)15-13-14-16-17-18(13)11-7-3-1-4-8-11/h2,5-6,9-11H,1,3-4,7-8H2,(H,14,15,17) |
| InChIKey | FNURTKASGRMJFO-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |