C6H10S4 — CID 124639166
(2R)-2-[(1R)-2,2-bis(sulfanyl)cyclopropyl]cyclopropane-1,1-dithiol (PubChem CID 124639166) has the molecular formula C6H10S4 and a molecular weight of 210.41 g/mol. Its IUPAC name is (2R)-2-[(1R)-2,2-bis(sulfanyl)cyclopropyl]cyclopropane-1,1-dithiol.
| Compound Name | (2R)-2-[(1R)-2,2-bis(sulfanyl)cyclopropyl]cyclopropane-1,1-dithiol |
|---|---|
| PubChem CID | 124639166 |
| Molecular Formula | C6H10S4 |
| Molecular Weight | 210.41 g/mol |
| Exact Mass | 209.97 |
| IUPAC Name | (2R)-2-[(1R)-2,2-bis(sulfanyl)cyclopropyl]cyclopropane-1,1-dithiol |
| SMILES | SC1(S)C[C@@H]1[C@H]1CC1(S)S |
| InChI | InChI=1S/C6H10S4/c7-5(8)1-3(5)4-2-6(4,9)10/h3-4,7-10H,1-2H2/t3-,4-/m1/s1 |
| InChIKey | LFWDUDBSYKOXBH-QWWZWVQMSA-N |
| XLogP | 2.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|