C10H13ClN4O — CID 124639362
6-chloro-9-[(2R)-oxan-2-yl]-7,8-dihydropurine (PubChem CID 124639362) has the molecular formula C10H13ClN4O and a molecular weight of 240.69 g/mol. Its IUPAC name is 6-chloro-9-[(2R)-oxan-2-yl]-7,8-dihydropurine.
| Compound Name | 6-chloro-9-[(2R)-oxan-2-yl]-7,8-dihydropurine |
|---|---|
| PubChem CID | 124639362 |
| Molecular Formula | C10H13ClN4O |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 6-chloro-9-[(2R)-oxan-2-yl]-7,8-dihydropurine |
| SMILES | Clc1ncnc2c1NCN2[C@H]1CCCCO1 |
| InChI | InChI=1S/C10H13ClN4O/c11-9-8-10(13-5-12-9)15(6-14-8)7-3-1-2-4-16-7/h5,7,14H,1-4,6H2/t7-/m1/s1 |
| InChIKey | URLCAVZGPKHDJM-SSDOTTSWSA-N |
| XLogP | 1.85 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |