C12H17ClN4O — CID 143466436
2-chloro-6-methyl-9-(oxepan-2-yl)-7,8-dihydropurine (PubChem CID 143466436) has the molecular formula C12H17ClN4O and a molecular weight of 268.75 g/mol. Its IUPAC name is 2-chloro-6-methyl-9-(oxepan-2-yl)-7,8-dihydropurine.
| Compound Name | 2-chloro-6-methyl-9-(oxepan-2-yl)-7,8-dihydropurine |
|---|---|
| PubChem CID | 143466436 |
| Molecular Formula | C12H17ClN4O |
| Molecular Weight | 268.75 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 2-chloro-6-methyl-9-(oxepan-2-yl)-7,8-dihydropurine |
| SMILES | Cc1nc(Cl)nc2c1NCN2C1CCCCCO1 |
| InChI | InChI=1S/C12H17ClN4O/c1-8-10-11(16-12(13)15-8)17(7-14-10)9-5-3-2-4-6-18-9/h9,14H,2-7H2,1H3 |
| InChIKey | KWZAQISWFHHPJQ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.75 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |