C8H8Br2O3 — CID 124640059
[(1R,6S)-4,6-dibromo-1-hydroxycyclohexa-2,4-dien-1-yl] acetate (PubChem CID 124640059) has the molecular formula C8H8Br2O3 and a molecular weight of 311.96 g/mol. Its IUPAC name is [(1R,6S)-4,6-dibromo-1-hydroxycyclohexa-2,4-dien-1-yl] acetate.
| Compound Name | [(1R,6S)-4,6-dibromo-1-hydroxycyclohexa-2,4-dien-1-yl] acetate |
|---|---|
| PubChem CID | 124640059 |
| Molecular Formula | C8H8Br2O3 |
| Molecular Weight | 311.96 g/mol |
| Exact Mass | 309.88 |
| IUPAC Name | [(1R,6S)-4,6-dibromo-1-hydroxycyclohexa-2,4-dien-1-yl] acetate |
| SMILES | CC(=O)O[C@]1(O)C=CC(Br)=C[C@@H]1Br |
| InChI | InChI=1S/C8H8Br2O3/c1-5(11)13-8(12)3-2-6(9)4-7(8)10/h2-4,7,12H,1H3/t7-,8+/m0/s1 |
| InChIKey | WBBLHDWZUURDCE-JGVFFNPUSA-N |
| XLogP | 1.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.96 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|