C11H21N3O — CID 124641834
N-[(3R)-8-methyl-1,8-diazaspiro[4.5]decan-3-yl]acetamide (PubChem CID 124641834) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is N-[(3R)-8-methyl-1,8-diazaspiro[4.5]decan-3-yl]acetamide.
| Compound Name | N-[(3R)-8-methyl-1,8-diazaspiro[4.5]decan-3-yl]acetamide |
|---|---|
| PubChem CID | 124641834 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | N-[(3R)-8-methyl-1,8-diazaspiro[4.5]decan-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1CNC2(CCN(C)CC2)C1 |
| InChI | InChI=1S/C11H21N3O/c1-9(15)13-10-7-11(12-8-10)3-5-14(2)6-4-11/h10,12H,3-8H2,1-2H3,(H,13,15)/t10-/m1/s1 |
| InChIKey | OBCZYVVMKFKYRC-SNVBAGLBSA-N |
| XLogP | -0.05 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |