C18H27NO4S2 — CID 124655054
(3R,4S)-N-cycloheptyl-4-(4-methylphenyl)sulfonyl-1,1-dioxothiolan-3-amine (PubChem CID 124655054) has the molecular formula C18H27NO4S2 and a molecular weight of 385.55 g/mol. Its IUPAC name is (3R,4S)-N-cycloheptyl-4-(4-methylphenyl)sulfonyl-1,1-dioxothiolan-3-amine.
| Compound Name | (3R,4S)-N-cycloheptyl-4-(4-methylphenyl)sulfonyl-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 124655054 |
| Molecular Formula | C18H27NO4S2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | (3R,4S)-N-cycloheptyl-4-(4-methylphenyl)sulfonyl-1,1-dioxothiolan-3-amine |
| SMILES | Cc1ccc(S(=O)(=O)[C@@H]2CS(=O)(=O)C[C@H]2NC2CCCCCC2)cc1 |
| InChI | InChI=1S/C18H27NO4S2/c1-14-8-10-16(11-9-14)25(22,23)18-13-24(20,21)12-17(18)19-15-6-4-2-3-5-7-15/h8-11,15,17-19H,2-7,12-13H2,1H3/t17-,18-/m1/s1 |
| InChIKey | CZVKXKAIRGLZMC-QZTJIDSGSA-N |
| XLogP | 2.25 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |