C11H14BN3O6 — CID 124668745
[3-[[(2S)-morpholin-2-yl]carbamoyl]-5-nitrophenyl]boronic acid (PubChem CID 124668745) has the molecular formula C11H14BN3O6 and a molecular weight of 295.06 g/mol. Its IUPAC name is [3-[[(2S)-morpholin-2-yl]carbamoyl]-5-nitrophenyl]boronic acid.
| Compound Name | [3-[[(2S)-morpholin-2-yl]carbamoyl]-5-nitrophenyl]boronic acid |
|---|---|
| PubChem CID | 124668745 |
| Molecular Formula | C11H14BN3O6 |
| Molecular Weight | 295.06 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | [3-[[(2S)-morpholin-2-yl]carbamoyl]-5-nitrophenyl]boronic acid |
| SMILES | O=C(N[C@@H]1CNCCO1)c1cc(B(O)O)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H14BN3O6/c16-11(14-10-6-13-1-2-21-10)7-3-8(12(17)18)5-9(4-7)15(19)20/h3-5,10,13,17-18H,1-2,6H2,(H,14,16)/t10-/m0/s1 |
| InChIKey | GBMFYOXRMJLZRJ-JTQLQIEISA-N |
| XLogP | -2.05 |
| TPSA | 133.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.06 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|