C24H29B2KN5O11- — CID 163370139
potassium;[3-[[2-[(3-borono-5-nitrobenzoyl)amino]cyclopentyl]-[2-(ethylamino)-2-oxoethyl]carbamoyl]-5-nitrophenyl]boronic acid;carbanide (PubChem CID 163370139) has the molecular formula C24H29B2KN5O11- and a molecular weight of 624.24 g/mol. Its IUPAC name is potassium;[3-[[2-[(3-borono-5-nitrobenzoyl)amino]cyclopentyl]-[2-(ethylamino)-2-oxoethyl]carbamoyl]-5-nitrophenyl]boronic acid;carbanide.
| Compound Name | potassium;[3-[[2-[(3-borono-5-nitrobenzoyl)amino]cyclopentyl]-[2-(ethylamino)-2-oxoethyl]carbamoyl]-5-nitrophenyl]boronic acid;carbanide |
|---|---|
| PubChem CID | 163370139 |
| Molecular Formula | C24H29B2KN5O11- |
| Molecular Weight | 624.24 g/mol |
| Exact Mass | 624.17 |
| IUPAC Name | potassium;[3-[[2-[(3-borono-5-nitrobenzoyl)amino]cyclopentyl]-[2-(ethylamino)-2-oxoethyl]carbamoyl]-5-nitrophenyl]boronic acid;carbanide |
| SMILES | [CH2-]CNC(=O)CN(C(=O)c1cc(B(O)O)cc([N+](=O)[O-])c1)C1CCCC1NC(=O)c1cc(B(O)O)cc([N+](=O)[O-])c1.[CH3-].[K+] |
| InChI | InChI=1S/C23H26B2N5O11.CH3.K/c1-2-26-21(31)12-28(23(33)14-7-16(25(36)37)11-18(9-14)30(40)41)20-5-3-4-19(20)27-22(32)13-6-15(24(34)35)10-17(8-13)29(38)39;;/h6-11,19-20,34-37H,1-5,12H2,(H,26,31)(H,27,32);1H3;/q2*-1;+1 |
| InChIKey | FTBHFUDIQOPIIC-UHFFFAOYSA-N |
| XLogP | -4.94 |
| TPSA | 245.71 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.24 |
| LogP ≤ 5 | -4.94 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|