C15H16N2 — CID 124673144
(5S)-1-benzyl-4,5-dihydroindol-5-amine (PubChem CID 124673144) has the molecular formula C15H16N2 and a molecular weight of 224.31 g/mol. Its IUPAC name is (5S)-1-benzyl-4,5-dihydroindol-5-amine.
| Compound Name | (5S)-1-benzyl-4,5-dihydroindol-5-amine |
|---|---|
| PubChem CID | 124673144 |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | (5S)-1-benzyl-4,5-dihydroindol-5-amine |
| SMILES | N[C@@H]1C=Cc2c(ccn2Cc2ccccc2)C1 |
| InChI | InChI=1S/C15H16N2/c16-14-6-7-15-13(10-14)8-9-17(15)11-12-4-2-1-3-5-12/h1-9,14H,10-11,16H2/t14-/m1/s1 |
| InChIKey | RPEFHEQMWFCSCX-CQSZACIVSA-N |
| XLogP | 2.43 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |