C11H17NO5 — CID 124673411
(2S)-3-(2-amino-4,6-dimethoxyphenoxy)propane-1,2-diol (PubChem CID 124673411) has the molecular formula C11H17NO5 and a molecular weight of 243.26 g/mol. Its IUPAC name is (2S)-3-(2-amino-4,6-dimethoxyphenoxy)propane-1,2-diol.
| Compound Name | (2S)-3-(2-amino-4,6-dimethoxyphenoxy)propane-1,2-diol |
|---|---|
| PubChem CID | 124673411 |
| Molecular Formula | C11H17NO5 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | (2S)-3-(2-amino-4,6-dimethoxyphenoxy)propane-1,2-diol |
| SMILES | COc1cc(N)c(OC[C@@H](O)CO)c(OC)c1 |
| InChI | InChI=1S/C11H17NO5/c1-15-8-3-9(12)11(10(4-8)16-2)17-6-7(14)5-13/h3-4,7,13-14H,5-6,12H2,1-2H3/t7-/m0/s1 |
| InChIKey | DEIUGOPSKRPWJM-ZETCQYMHSA-N |
| XLogP | 0.02 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|