C12H19NO5S — CID 124673409
2-[(R)-2-(2-amino-4,6-dimethoxyphenoxy)ethylsulfinyl]ethanol (PubChem CID 124673409) has the molecular formula C12H19NO5S and a molecular weight of 289.35 g/mol. Its IUPAC name is 2-[(R)-2-(2-amino-4,6-dimethoxyphenoxy)ethylsulfinyl]ethanol.
| Compound Name | 2-[(R)-2-(2-amino-4,6-dimethoxyphenoxy)ethylsulfinyl]ethanol |
|---|---|
| PubChem CID | 124673409 |
| Molecular Formula | C12H19NO5S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.10 |
| IUPAC Name | 2-[(R)-2-(2-amino-4,6-dimethoxyphenoxy)ethylsulfinyl]ethanol |
| SMILES | COc1cc(N)c(OCC[S@](=O)CCO)c(OC)c1 |
| InChI | InChI=1S/C12H19NO5S/c1-16-9-7-10(13)12(11(8-9)17-2)18-4-6-19(15)5-3-14/h7-8,14H,3-6,13H2,1-2H3/t19-/m1/s1 |
| InChIKey | ZAHDNBIBVVDZJJ-LJQANCHMSA-N |
| XLogP | 0.41 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|