C11H19ClN4O2S — CID 124698341
2-chloro-1-methyl-N-[2-[(3S)-piperidin-3-yl]ethyl]imidazole-4-sulfonamide (PubChem CID 124698341) has the molecular formula C11H19ClN4O2S and a molecular weight of 306.82 g/mol. Its IUPAC name is 2-chloro-1-methyl-N-[2-[(3S)-piperidin-3-yl]ethyl]imidazole-4-sulfonamide.
| Compound Name | 2-chloro-1-methyl-N-[2-[(3S)-piperidin-3-yl]ethyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 124698341 |
| Molecular Formula | C11H19ClN4O2S |
| Molecular Weight | 306.82 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-chloro-1-methyl-N-[2-[(3S)-piperidin-3-yl]ethyl]imidazole-4-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NCC[C@@H]2CCCNC2)nc1Cl |
| InChI | InChI=1S/C11H19ClN4O2S/c1-16-8-10(15-11(16)12)19(17,18)14-6-4-9-3-2-5-13-7-9/h8-9,13-14H,2-7H2,1H3/t9-/m0/s1 |
| InChIKey | AMUBYZSYLSTEOI-VIFPVBQESA-N |
| XLogP | 0.74 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.82 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |