C10H17NO3 — CID 124709767
methyl (2S,3aS,5R,7aR)-5-methyl-2,3,3a,4,5,6,7,7a-octahydrofuro[3,2-b]pyridine-2-carboxylate (PubChem CID 124709767) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is methyl (2S,3aS,5R,7aR)-5-methyl-2,3,3a,4,5,6,7,7a-octahydrofuro[3,2-b]pyridine-2-carboxylate.
| Compound Name | methyl (2S,3aS,5R,7aR)-5-methyl-2,3,3a,4,5,6,7,7a-octahydrofuro[3,2-b]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 124709767 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | methyl (2S,3aS,5R,7aR)-5-methyl-2,3,3a,4,5,6,7,7a-octahydrofuro[3,2-b]pyridine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2N[C@H](C)CC[C@H]2O1 |
| InChI | InChI=1S/C10H17NO3/c1-6-3-4-8-7(11-6)5-9(14-8)10(12)13-2/h6-9,11H,3-5H2,1-2H3/t6-,7+,8-,9+/m1/s1 |
| InChIKey | OKOJKJVMRGFNAN-XAVMHZPKSA-N |
| XLogP | 0.46 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |