C17H26N4O — CID 124744072
(3S)-3-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one (PubChem CID 124744072) has the molecular formula C17H26N4O and a molecular weight of 302.42 g/mol. Its IUPAC name is (3S)-3-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one.
| Compound Name | (3S)-3-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 124744072 |
| Molecular Formula | C17H26N4O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.21 |
| IUPAC Name | (3S)-3-[[(1S,6S)-2,6-dimethylcyclohex-2-en-1-yl]methylamino]-1-(1-methylpyrazol-4-yl)pyrrolidin-2-one |
| SMILES | CC1=CCC[C@H](C)[C@@H]1CN[C@H]1CCN(c2cnn(C)c2)C1=O |
| InChI | InChI=1S/C17H26N4O/c1-12-5-4-6-13(2)15(12)10-18-16-7-8-21(17(16)22)14-9-19-20(3)11-14/h5,9,11,13,15-16,18H,4,6-8,10H2,1-3H3/t13-,15+,16-/m0/s1 |
| InChIKey | ZJUHQXQVLAXZSC-IMJJTQAJSA-N |
| XLogP | 2.11 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|