C16H26N2O3 — CID 124744617
(3S,4R)-1-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]piperidin-4-amine (PubChem CID 124744617) has the molecular formula C16H26N2O3 and a molecular weight of 294.39 g/mol. Its IUPAC name is (3S,4R)-1-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]piperidin-4-amine.
| Compound Name | (3S,4R)-1-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 124744617 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | (3S,4R)-1-methyl-3-[(2,3,4-trimethoxyphenyl)methyl]piperidin-4-amine |
| SMILES | COc1ccc(C[C@H]2CN(C)CC[C@H]2N)c(OC)c1OC |
| InChI | InChI=1S/C16H26N2O3/c1-18-8-7-13(17)12(10-18)9-11-5-6-14(19-2)16(21-4)15(11)20-3/h5-6,12-13H,7-10,17H2,1-4H3/t12-,13+/m0/s1 |
| InChIKey | AGGSXHAAIPDJDW-QWHCGFSZSA-N |
| XLogP | 1.53 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |