C14H25N5OS2 — CID 124751530
2-[(2S)-1,4-dimethylpiperazin-2-yl]-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]acetamide (PubChem CID 124751530) has the molecular formula C14H25N5OS2 and a molecular weight of 343.52 g/mol. Its IUPAC name is 2-[(2S)-1,4-dimethylpiperazin-2-yl]-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]acetamide.
| Compound Name | 2-[(2S)-1,4-dimethylpiperazin-2-yl]-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]acetamide |
|---|---|
| PubChem CID | 124751530 |
| Molecular Formula | C14H25N5OS2 |
| Molecular Weight | 343.52 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-[(2S)-1,4-dimethylpiperazin-2-yl]-N-[3-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]propyl]acetamide |
| SMILES | Cc1nnc(SCCCNC(=O)C[C@H]2CN(C)CCN2C)s1 |
| InChI | InChI=1S/C14H25N5OS2/c1-11-16-17-14(22-11)21-8-4-5-15-13(20)9-12-10-18(2)6-7-19(12)3/h12H,4-10H2,1-3H3,(H,15,20)/t12-/m0/s1 |
| InChIKey | GUZPEXRLWDOHHY-LBPRGKRZSA-N |
| XLogP | 1.08 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.52 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|