C16H22N4O5S2 — CID 1247634
4-(4-nitrophenyl)sulfonyl-N-[[(2S)-oxolan-2-yl]methyl]piperazine-1-carbothioamide (PubChem CID 1247634) has the molecular formula C16H22N4O5S2 and a molecular weight of 414.51 g/mol. Its IUPAC name is 4-(4-nitrophenyl)sulfonyl-N-[[(2S)-oxolan-2-yl]methyl]piperazine-1-carbothioamide.
| Compound Name | 4-(4-nitrophenyl)sulfonyl-N-[[(2S)-oxolan-2-yl]methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 1247634 |
| Molecular Formula | C16H22N4O5S2 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 4-(4-nitrophenyl)sulfonyl-N-[[(2S)-oxolan-2-yl]methyl]piperazine-1-carbothioamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N2CCN(C(=S)NC[C@@H]3CCCO3)CC2)cc1 |
| InChI | InChI=1S/C16H22N4O5S2/c21-20(22)13-3-5-15(6-4-13)27(23,24)19-9-7-18(8-10-19)16(26)17-12-14-2-1-11-25-14/h3-6,14H,1-2,7-12H2,(H,17,26)/t14-/m0/s1 |
| InChIKey | UMEZOGFKDMDUAS-AWEZNQCLSA-N |
| XLogP | 0.95 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|