C17H24O4 — CID 124767739
cis-(1S,3S)-3-[(1R,2R)-1,2-dihydroxy-2-phenylethyl]-1,2,2-trimethylcyclopentane-1-carboxylic acid (PubChem CID 124767739) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is cis-(1S,3S)-3-[(1R,2R)-1,2-dihydroxy-2-phenylethyl]-1,2,2-trimethylcyclopentane-1-carboxylic acid.
| Compound Name | cis-(1S,3S)-3-[(1R,2R)-1,2-dihydroxy-2-phenylethyl]-1,2,2-trimethylcyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 124767739 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | cis-(1S,3S)-3-[(1R,2R)-1,2-dihydroxy-2-phenylethyl]-1,2,2-trimethylcyclopentane-1-carboxylic acid |
| SMILES | CC1(C)[C@@H]([C@@H](O)[C@H](O)c2ccccc2)CC[C@]1(C)C(=O)O |
| InChI | InChI=1S/C17H24O4/c1-16(2)12(9-10-17(16,3)15(20)21)14(19)13(18)11-7-5-4-6-8-11/h4-8,12-14,18-19H,9-10H2,1-3H3,(H,20,21)/t12-,13-,14-,17-/m1/s1 |
| InChIKey | DIDBNOMHOXVHIY-VMUDFCTBSA-N |
| XLogP | 2.61 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |