C26H29N3O3 — CID 124770912
(3S,4S,8R,9R)-6-[(2S)-butan-2-yl]-3-(2,2-dimethylpropanoyl)-2,6,19-triazapentacyclo[10.8.0.02,9.04,8.015,20]icosa-1(12),10,13,15(20),16,18-hexaene-5,7-dione (PubChem CID 124770912) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is (3S,4S,8R,9R)-6-[(2S)-butan-2-yl]-3-(2,2-dimethylpropanoyl)-2,6,19-triazapentacyclo[10.8.0.02,9.04,8.015,20]icosa-1(12),10,13,15(20),16,18-hexaene-5,7-dione.
| Compound Name | (3S,4S,8R,9R)-6-[(2S)-butan-2-yl]-3-(2,2-dimethylpropanoyl)-2,6,19-triazapentacyclo[10.8.0.02,9.04,8.015,20]icosa-1(12),10,13,15(20),16,18-hexaene-5,7-dione |
|---|---|
| PubChem CID | 124770912 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | (3S,4S,8R,9R)-6-[(2S)-butan-2-yl]-3-(2,2-dimethylpropanoyl)-2,6,19-triazapentacyclo[10.8.0.02,9.04,8.015,20]icosa-1(12),10,13,15(20),16,18-hexaene-5,7-dione |
| SMILES | CC[C@H](C)N1C(=O)[C@@H]2[C@H](C1=O)[C@@H](C(=O)C(C)(C)C)N1c3c(ccc4cccnc34)C=C[C@H]21 |
| InChI | InChI=1S/C26H29N3O3/c1-6-14(2)28-24(31)18-17-12-11-16-10-9-15-8-7-13-27-20(15)21(16)29(17)22(19(18)25(28)32)23(30)26(3,4)5/h7-14,17-19,22H,6H2,1-5H3/t14-,17+,18-,19-,22-/m0/s1 |
| InChIKey | AFBKHIUFLLKDFT-LYIMUSMJSA-N |
| XLogP | 3.83 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|