C21H20ClF3N4O5 — CID 124826575
ethyl (1S,2R,6R,7S,8S,12S)-10-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-5-carboxylate (PubChem CID 124826575) has the molecular formula C21H20ClF3N4O5 and a molecular weight of 500.86 g/mol. Its IUPAC name is ethyl (1S,2R,6R,7S,8S,12S)-10-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-5-carboxylate.
| Compound Name | ethyl (1S,2R,6R,7S,8S,12S)-10-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-5-carboxylate |
|---|---|
| PubChem CID | 124826575 |
| Molecular Formula | C21H20ClF3N4O5 |
| Molecular Weight | 500.86 g/mol |
| Exact Mass | 500.11 |
| IUPAC Name | ethyl (1S,2R,6R,7S,8S,12S)-10-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-5-carboxylate |
| SMILES | CCOC(=O)C1=NO[C@@H]2[C@H]3C[C@@H]([C@H]12)[C@@H]1C(=O)N(CCNc2ncc(C(F)(F)F)cc2Cl)C(=O)[C@@H]31 |
| InChI | InChI=1S/C21H20ClF3N4O5/c1-2-33-20(32)15-14-9-6-10(16(14)34-28-15)13-12(9)18(30)29(19(13)31)4-3-26-17-11(22)5-8(7-27-17)21(23,24)25/h5,7,9-10,12-14,16H,2-4,6H2,1H3,(H,26,27)/t9-,10+,12+,13+,14-,16-/m1/s1 |
| InChIKey | OXPDVIMGYINVSJ-BNNFPGKKSA-N |
| XLogP | 2.35 |
| TPSA | 110.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.86 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|