C19H16ClF3N4O5 — CID 124780873
(1S,2R,6R,7S,8S,12R)-10-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-5-carboxylic acid (PubChem CID 124780873) has the molecular formula C19H16ClF3N4O5 and a molecular weight of 472.81 g/mol. Its IUPAC name is (1S,2R,6R,7S,8S,12R)-10-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-5-carboxylic acid.
| Compound Name | (1S,2R,6R,7S,8S,12R)-10-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-5-carboxylic acid |
|---|---|
| PubChem CID | 124780873 |
| Molecular Formula | C19H16ClF3N4O5 |
| Molecular Weight | 472.81 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | (1S,2R,6R,7S,8S,12R)-10-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-9,11-dioxo-3-oxa-4,10-diazatetracyclo[5.5.1.02,6.08,12]tridec-4-ene-5-carboxylic acid |
| SMILES | O=C(O)C1=NO[C@@H]2[C@H]3C[C@@H]([C@H]12)[C@@H]1C(=O)N(CCNc2ncc(C(F)(F)F)cc2Cl)C(=O)[C@H]31 |
| InChI | InChI=1S/C19H16ClF3N4O5/c20-9-3-6(19(21,22)23)5-25-15(9)24-1-2-27-16(28)10-7-4-8(11(10)17(27)29)14-12(7)13(18(30)31)26-32-14/h3,5,7-8,10-12,14H,1-2,4H2,(H,24,25)(H,30,31)/t7-,8+,10+,11-,12-,14-/m1/s1 |
| InChIKey | VHWWMGQZRGACBA-LXXVUHEWSA-N |
| XLogP | 1.87 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.81 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|