C24H16ClF3N4O6 — CID 136668878
(1S,3aS,6aS)-5-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-(1-hydroxy-3-oxoinden-2-yl)-4,6-dioxo-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-1-carboxylic acid (PubChem CID 136668878) has the molecular formula C24H16ClF3N4O6 and a molecular weight of 548.86 g/mol. Its IUPAC name is (1S,3aS,6aS)-5-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-(1-hydroxy-3-oxoinden-2-yl)-4,6-dioxo-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-1-carboxylic acid.
| Compound Name | (1S,3aS,6aS)-5-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-(1-hydroxy-3-oxoinden-2-yl)-4,6-dioxo-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-1-carboxylic acid |
|---|---|
| PubChem CID | 136668878 |
| Molecular Formula | C24H16ClF3N4O6 |
| Molecular Weight | 548.86 g/mol |
| Exact Mass | 548.07 |
| IUPAC Name | (1S,3aS,6aS)-5-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-3-(1-hydroxy-3-oxoinden-2-yl)-4,6-dioxo-3a,6a-dihydro-1H-pyrrolo[3,4-c]pyrrole-1-carboxylic acid |
| SMILES | O=C1C(C2=N[C@H](C(=O)O)[C@H]3C(=O)N(CCNc4ncc(C(F)(F)F)cc4Cl)C(=O)[C@H]23)=C(O)c2ccccc21 |
| InChI | InChI=1S/C24H16ClF3N4O6/c25-12-7-9(24(26,27)28)8-30-20(12)29-5-6-32-21(35)13-14(22(32)36)17(23(37)38)31-16(13)15-18(33)10-3-1-2-4-11(10)19(15)34/h1-4,7-8,13-14,17,33H,5-6H2,(H,29,30)(H,37,38)/t13-,14-,17-/m0/s1 |
| InChIKey | AXPQYEJHEOPSMS-ZQIUZPCESA-N |
| XLogP | 2.84 |
| TPSA | 149.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.86 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_C(7)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|