C19H19N3O3S — CID 124827707
(3aR,4S,5R,7aS)-N-(1,3-benzothiazol-2-ylmethyl)-2,5-dimethyl-1,3-dioxo-3a,4,5,7a-tetrahydroisoindole-4-carboxamide (PubChem CID 124827707) has the molecular formula C19H19N3O3S and a molecular weight of 369.45 g/mol. Its IUPAC name is (3aR,4S,5R,7aS)-N-(1,3-benzothiazol-2-ylmethyl)-2,5-dimethyl-1,3-dioxo-3a,4,5,7a-tetrahydroisoindole-4-carboxamide.
| Compound Name | (3aR,4S,5R,7aS)-N-(1,3-benzothiazol-2-ylmethyl)-2,5-dimethyl-1,3-dioxo-3a,4,5,7a-tetrahydroisoindole-4-carboxamide |
|---|---|
| PubChem CID | 124827707 |
| Molecular Formula | C19H19N3O3S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | (3aR,4S,5R,7aS)-N-(1,3-benzothiazol-2-ylmethyl)-2,5-dimethyl-1,3-dioxo-3a,4,5,7a-tetrahydroisoindole-4-carboxamide |
| SMILES | C[C@@H]1C=C[C@@H]2C(=O)N(C)C(=O)[C@@H]2[C@H]1C(=O)NCc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H19N3O3S/c1-10-7-8-11-16(19(25)22(2)18(11)24)15(10)17(23)20-9-14-21-12-5-3-4-6-13(12)26-14/h3-8,10-11,15-16H,9H2,1-2H3,(H,20,23)/t10-,11+,15+,16+/m1/s1 |
| InChIKey | SRMHUPMFIQBFRA-OVTCNUJSSA-N |
| XLogP | 1.97 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|