C11H12 — CID 124834846
(1R,2R,3R,6R,7S,8S)-4-ethenylpentacyclo[4.3.0.02,4.03,8.05,7]nonane (PubChem CID 124834846) has the molecular formula C11H12 and a molecular weight of 144.22 g/mol. Its IUPAC name is (1R,2R,3R,6R,7S,8S)-4-ethenylpentacyclo[4.3.0.02,4.03,8.05,7]nonane.
| Compound Name | (1R,2R,3R,6R,7S,8S)-4-ethenylpentacyclo[4.3.0.02,4.03,8.05,7]nonane |
|---|---|
| PubChem CID | 124834846 |
| Molecular Formula | C11H12 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | (1R,2R,3R,6R,7S,8S)-4-ethenylpentacyclo[4.3.0.02,4.03,8.05,7]nonane |
| SMILES | C=CC12C3[C@@H]4[C@H]5C[C@@H]([C@H]34)[C@@H]1[C@@H]52 |
| InChI | InChI=1S/C11H12/c1-2-11-8-4-3-5(9(8)11)7-6(4)10(7)11/h2,4-10H,1,3H2/t4-,5+,6-,7+,8-,9-,10?,11?/m1/s1 |
| InChIKey | AECNVNHSMYWLCL-QTISTPSASA-N |
| XLogP | 1.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|