C18H23N5O2 — CID 124843438
(3R)-1-N-(5-ethyl-1-phenylpyrazol-4-yl)piperidine-1,3-dicarboxamide (PubChem CID 124843438) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is (3R)-1-N-(5-ethyl-1-phenylpyrazol-4-yl)piperidine-1,3-dicarboxamide.
| Compound Name | (3R)-1-N-(5-ethyl-1-phenylpyrazol-4-yl)piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 124843438 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | (3R)-1-N-(5-ethyl-1-phenylpyrazol-4-yl)piperidine-1,3-dicarboxamide |
| SMILES | CCc1c(NC(=O)N2CCC[C@@H](C(N)=O)C2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C18H23N5O2/c1-2-16-15(11-20-23(16)14-8-4-3-5-9-14)21-18(25)22-10-6-7-13(12-22)17(19)24/h3-5,8-9,11,13H,2,6-7,10,12H2,1H3,(H2,19,24)(H,21,25)/t13-/m1/s1 |
| InChIKey | DRZUWJOUIUXDMQ-CYBMUJFWSA-N |
| XLogP | 2.16 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |